C16H24FN3 — CID 60918844
2-cyclopropyl-1-[4-(2-fluorophenyl)piperazin-1-yl]propan-2-amine (PubChem CID 60918844) has the molecular formula C16H24FN3 and a molecular weight of 277.39 g/mol. Its IUPAC name is 2-cyclopropyl-1-[4-(2-fluorophenyl)piperazin-1-yl]propan-2-amine.
| Compound Name | 2-cyclopropyl-1-[4-(2-fluorophenyl)piperazin-1-yl]propan-2-amine |
|---|---|
| PubChem CID | 60918844 |
| Molecular Formula | C16H24FN3 |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 2-cyclopropyl-1-[4-(2-fluorophenyl)piperazin-1-yl]propan-2-amine |
| SMILES | CC(N)(CN1CCN(c2ccccc2F)CC1)C1CC1 |
| InChI | InChI=1S/C16H24FN3/c1-16(18,13-6-7-13)12-19-8-10-20(11-9-19)15-5-3-2-4-14(15)17/h2-5,13H,6-12,18H2,1H3 |
| InChIKey | PLRVJMZWHBGLOC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |