C22H30FN5O2 — CID 111805716
1-(2,5-dimethoxyphenyl)-2-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]guanidine (PubChem CID 111805716) has the molecular formula C22H30FN5O2 and a molecular weight of 415.51 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-2-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]guanidine.
| Compound Name | 1-(2,5-dimethoxyphenyl)-2-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]guanidine |
|---|---|
| PubChem CID | 111805716 |
| Molecular Formula | C22H30FN5O2 |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-2-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]guanidine |
| SMILES | COc1ccc(OC)c(N/C(N)=N/CCCN2CCN(c3ccccc3F)CC2)c1 |
| InChI | InChI=1S/C22H30FN5O2/c1-29-17-8-9-21(30-2)19(16-17)26-22(24)25-10-5-11-27-12-14-28(15-13-27)20-7-4-3-6-18(20)23/h3-4,6-9,16H,5,10-15H2,1-2H3,(H3,24,25,26) |
| InChIKey | XDZFDCBTNOMQRF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|