C20H26FN5O — CID 111061989
2-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-1-(2-methoxyphenyl)guanidine (PubChem CID 111061989) has the molecular formula C20H26FN5O and a molecular weight of 371.46 g/mol. Its IUPAC name is 2-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-1-(2-methoxyphenyl)guanidine.
| Compound Name | 2-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-1-(2-methoxyphenyl)guanidine |
|---|---|
| PubChem CID | 111061989 |
| Molecular Formula | C20H26FN5O |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | 2-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-1-(2-methoxyphenyl)guanidine |
| SMILES | COc1ccccc1N/C(N)=N/CCN1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H26FN5O/c1-27-19-5-3-2-4-18(19)24-20(22)23-10-11-25-12-14-26(15-13-25)17-8-6-16(21)7-9-17/h2-9H,10-15H2,1H3,(H3,22,23,24) |
| InChIKey | VPIVTBQBSVUQSF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 66.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|