C16H26FN5 — CID 111061999
1-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-2-propylguanidine (PubChem CID 111061999) has the molecular formula C16H26FN5 and a molecular weight of 307.42 g/mol. Its IUPAC name is 1-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-2-propylguanidine.
| Compound Name | 1-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-2-propylguanidine |
|---|---|
| PubChem CID | 111061999 |
| Molecular Formula | C16H26FN5 |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.22 |
| IUPAC Name | 1-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-2-propylguanidine |
| SMILES | CCC/N=C(\N)NCCN1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H26FN5/c1-2-7-19-16(18)20-8-9-21-10-12-22(13-11-21)15-5-3-14(17)4-6-15/h3-6H,2,7-13H2,1H3,(H3,18,19,20) |
| InChIKey | MHZSLHLYOVRNOB-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|