C21H28ClN5O — CID 111082407
2-[3-[4-(2-chlorophenyl)piperazin-1-yl]propyl]-1-(2-methoxyphenyl)guanidine (PubChem CID 111082407) has the molecular formula C21H28ClN5O and a molecular weight of 401.94 g/mol. Its IUPAC name is 2-[3-[4-(2-chlorophenyl)piperazin-1-yl]propyl]-1-(2-methoxyphenyl)guanidine.
| Compound Name | 2-[3-[4-(2-chlorophenyl)piperazin-1-yl]propyl]-1-(2-methoxyphenyl)guanidine |
|---|---|
| PubChem CID | 111082407 |
| Molecular Formula | C21H28ClN5O |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 2-[3-[4-(2-chlorophenyl)piperazin-1-yl]propyl]-1-(2-methoxyphenyl)guanidine |
| SMILES | COc1ccccc1N/C(N)=N/CCCN1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C21H28ClN5O/c1-28-20-10-5-3-8-18(20)25-21(23)24-11-6-12-26-13-15-27(16-14-26)19-9-4-2-7-17(19)22/h2-5,7-10H,6,11-16H2,1H3,(H3,23,24,25) |
| InChIKey | JQTLOTGYCFZELM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 66.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|