C23H33ClIN5O — CID 110926864
2-[3-[4-(2-chlorophenyl)piperazin-1-yl]propyl]-1-[2-(4-methoxyphenyl)ethyl]guanidine;hydroiodide (PubChem CID 110926864) has the molecular formula C23H33ClIN5O and a molecular weight of 557.91 g/mol. Its IUPAC name is 2-[3-[4-(2-chlorophenyl)piperazin-1-yl]propyl]-1-[2-(4-methoxyphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[3-[4-(2-chlorophenyl)piperazin-1-yl]propyl]-1-[2-(4-methoxyphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110926864 |
| Molecular Formula | C23H33ClIN5O |
| Molecular Weight | 557.91 g/mol |
| Exact Mass | 557.14 |
| IUPAC Name | 2-[3-[4-(2-chlorophenyl)piperazin-1-yl]propyl]-1-[2-(4-methoxyphenyl)ethyl]guanidine;hydroiodide |
| SMILES | COc1ccc(CCN/C(N)=N/CCCN2CCN(c3ccccc3Cl)CC2)cc1.I |
| InChI | InChI=1S/C23H32ClN5O.HI/c1-30-20-9-7-19(8-10-20)11-13-27-23(25)26-12-4-14-28-15-17-29(18-16-28)22-6-3-2-5-21(22)24;/h2-3,5-10H,4,11-18H2,1H3,(H3,25,26,27);1H |
| InChIKey | JGJVEFHVPAHQHZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 66.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.91 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|