C42H69ClN4O4S2 — CID 160823618
3-(3-hexyl-6-propyl-3-azabicyclo[3.1.0]hexan-6-yl)aniline;N-[3-(3-hexyl-6-propyl-3-azabicyclo[3.1.0]hexan-6-yl)phenyl]methanesulfonamide;methanesulfonyl chloride (PubChem CID 160823618) has the molecular formula C42H69ClN4O4S2 and a molecular weight of 793.62 g/mol. Its IUPAC name is 3-(3-hexyl-6-propyl-3-azabicyclo[3.1.0]hexan-6-yl)aniline;N-[3-(3-hexyl-6-propyl-3-azabicyclo[3.1.0]hexan-6-yl)phenyl]methanesulfonamide;methanesulfonyl chloride.
| Compound Name | 3-(3-hexyl-6-propyl-3-azabicyclo[3.1.0]hexan-6-yl)aniline;N-[3-(3-hexyl-6-propyl-3-azabicyclo[3.1.0]hexan-6-yl)phenyl]methanesulfonamide;methanesulfonyl chloride |
|---|---|
| PubChem CID | 160823618 |
| Molecular Formula | C42H69ClN4O4S2 |
| Molecular Weight | 793.62 g/mol |
| Exact Mass | 792.44 |
| IUPAC Name | 3-(3-hexyl-6-propyl-3-azabicyclo[3.1.0]hexan-6-yl)aniline;N-[3-(3-hexyl-6-propyl-3-azabicyclo[3.1.0]hexan-6-yl)phenyl]methanesulfonamide;methanesulfonyl chloride |
| SMILES | CCCCCCN1CC2C(C1)C2(CCC)c1cccc(N)c1.CCCCCCN1CC2C(C1)C2(CCC)c1cccc(NS(C)(=O)=O)c1.CS(=O)(=O)Cl |
| InChI | InChI=1S/C21H34N2O2S.C20H32N2.CH3ClO2S/c1-4-6-7-8-13-23-15-19-20(16-23)21(19,12-5-2)17-10-9-11-18(14-17)22-26(3,24)25;1-3-5-6-7-12-22-14-18-19(15-22)20(18,11-4-2)16-9-8-10-17(21)13-16;1-5(2,3)4/h9-11,14,19-20,22H,4-8,12-13,15-16H2,1-3H3;8-10,13,18-19H,3-7,11-12,14-15,21H2,1-2H3;1H3 |
| InChIKey | SFWFARXGLWBADI-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.62 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|