C42H69ClN4O4S2 — CID 157109541
ethanesulfonyl chloride;3-(6-ethyl-3-hexyl-3-azabicyclo[3.1.0]hexan-6-yl)aniline;N-[3-(6-ethyl-3-hexyl-3-azabicyclo[3.1.0]hexan-6-yl)phenyl]ethanesulfonamide (PubChem CID 157109541) has the molecular formula C42H69ClN4O4S2 and a molecular weight of 793.62 g/mol. Its IUPAC name is ethanesulfonyl chloride;3-(6-ethyl-3-hexyl-3-azabicyclo[3.1.0]hexan-6-yl)aniline;N-[3-(6-ethyl-3-hexyl-3-azabicyclo[3.1.0]hexan-6-yl)phenyl]ethanesulfonamide.
| Compound Name | ethanesulfonyl chloride;3-(6-ethyl-3-hexyl-3-azabicyclo[3.1.0]hexan-6-yl)aniline;N-[3-(6-ethyl-3-hexyl-3-azabicyclo[3.1.0]hexan-6-yl)phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 157109541 |
| Molecular Formula | C42H69ClN4O4S2 |
| Molecular Weight | 793.62 g/mol |
| Exact Mass | 792.44 |
| IUPAC Name | ethanesulfonyl chloride;3-(6-ethyl-3-hexyl-3-azabicyclo[3.1.0]hexan-6-yl)aniline;N-[3-(6-ethyl-3-hexyl-3-azabicyclo[3.1.0]hexan-6-yl)phenyl]ethanesulfonamide |
| SMILES | CCCCCCN1CC2C(C1)C2(CC)c1cccc(N)c1.CCCCCCN1CC2C(C1)C2(CC)c1cccc(NS(=O)(=O)CC)c1.CCS(=O)(=O)Cl |
| InChI | InChI=1S/C21H34N2O2S.C19H30N2.C2H5ClO2S/c1-4-7-8-9-13-23-15-19-20(16-23)21(19,5-2)17-11-10-12-18(14-17)22-26(24,25)6-3;1-3-5-6-7-11-21-13-17-18(14-21)19(17,4-2)15-9-8-10-16(20)12-15;1-2-6(3,4)5/h10-12,14,19-20,22H,4-9,13,15-16H2,1-3H3;8-10,12,17-18H,3-7,11,13-14,20H2,1-2H3;2H2,1H3 |
| InChIKey | AGRLKOVOLKJQIL-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.62 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|