C28H36N2O3 — CID 70340100
benzyl N-[(4aR,6S,8aS)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-methylcarbamate (PubChem CID 70340100) has the molecular formula C28H36N2O3 and a molecular weight of 448.61 g/mol. Its IUPAC name is benzyl N-[(4aR,6S,8aS)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-methylcarbamate.
| Compound Name | benzyl N-[(4aR,6S,8aS)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 70340100 |
| Molecular Formula | C28H36N2O3 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | benzyl N-[(4aR,6S,8aS)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OCc1ccccc1)[C@H]1CC[C@@H]2CN(CC3CC3)CC[C@@]2(c2cccc(O)c2)C1 |
| InChI | InChI=1S/C28H36N2O3/c1-29(27(32)33-20-22-6-3-2-4-7-22)25-13-12-24-19-30(18-21-10-11-21)15-14-28(24,17-25)23-8-5-9-26(31)16-23/h2-9,16,21,24-25,31H,10-15,17-20H2,1H3/t24-,25+,28+/m1/s1 |
| InChIKey | SQYLZCSIZGXJLR-QQNWGBJXSA-N |
| XLogP | 5.18 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |