C31H38Cl2N2O4 — CID 70337326
[2-(cyclopropylmethyl)-6-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-4a-(3-methoxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate (PubChem CID 70337326) has the molecular formula C31H38Cl2N2O4 and a molecular weight of 573.56 g/mol. Its IUPAC name is [2-(cyclopropylmethyl)-6-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-4a-(3-methoxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate.
| Compound Name | [2-(cyclopropylmethyl)-6-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-4a-(3-methoxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate |
|---|---|
| PubChem CID | 70337326 |
| Molecular Formula | C31H38Cl2N2O4 |
| Molecular Weight | 573.56 g/mol |
| Exact Mass | 572.22 |
| IUPAC Name | [2-(cyclopropylmethyl)-6-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-4a-(3-methoxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate |
| SMILES | COc1cccc(C23CCN(CC4CC4)CC2(OC(C)=O)CCC(N(C)C(=O)Cc2ccc(Cl)c(Cl)c2)C3)c1 |
| InChI | InChI=1S/C31H38Cl2N2O4/c1-21(36)39-31-12-11-25(34(2)29(37)16-23-9-10-27(32)28(33)15-23)18-30(31,24-5-4-6-26(17-24)38-3)13-14-35(20-31)19-22-7-8-22/h4-6,9-10,15,17,22,25H,7-8,11-14,16,18-20H2,1-3H3 |
| InChIKey | LJWLVHNQSTZILY-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.56 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |