C26H34N2O3 — CID 57261103
N-[(4aR,6R,8aS)-8-methoxy-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-methylbenzamide (PubChem CID 57261103) has the molecular formula C26H34N2O3 and a molecular weight of 422.57 g/mol. Its IUPAC name is N-[(4aR,6R,8aS)-8-methoxy-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-methylbenzamide.
| Compound Name | N-[(4aR,6R,8aS)-8-methoxy-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 57261103 |
| Molecular Formula | C26H34N2O3 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | N-[(4aR,6R,8aS)-8-methoxy-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-methylbenzamide |
| SMILES | COc1cccc([C@@]23CCN(C)C[C@H]2C(OC)C[C@H](N(C)C(=O)c2ccccc2)C3)c1 |
| InChI | InChI=1S/C26H34N2O3/c1-27-14-13-26(20-11-8-12-22(15-20)30-3)17-21(16-24(31-4)23(26)18-27)28(2)25(29)19-9-6-5-7-10-19/h5-12,15,21,23-24H,13-14,16-18H2,1-4H3/t21-,23-,24?,26-/m0/s1 |
| InChIKey | BYDBJNFYPRMDCF-PQHIUQKKSA-N |
| XLogP | 3.83 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |