C29H40N2O3 — CID 67728262
N-[(4aR,6R,8aS)-8-methoxy-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-(2-methylpropyl)benzamide (PubChem CID 67728262) has the molecular formula C29H40N2O3 and a molecular weight of 464.65 g/mol. Its IUPAC name is N-[(4aR,6R,8aS)-8-methoxy-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-(2-methylpropyl)benzamide.
| Compound Name | N-[(4aR,6R,8aS)-8-methoxy-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 67728262 |
| Molecular Formula | C29H40N2O3 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.30 |
| IUPAC Name | N-[(4aR,6R,8aS)-8-methoxy-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-(2-methylpropyl)benzamide |
| SMILES | COc1cccc([C@@]23CCN(C)C[C@H]2C(OC)C[C@H](N(CC(C)C)C(=O)c2ccccc2)C3)c1 |
| InChI | InChI=1S/C29H40N2O3/c1-21(2)19-31(28(32)22-10-7-6-8-11-22)24-17-27(34-5)26-20-30(3)15-14-29(26,18-24)23-12-9-13-25(16-23)33-4/h6-13,16,21,24,26-27H,14-15,17-20H2,1-5H3/t24-,26-,27?,29-/m0/s1 |
| InChIKey | DWDBPPKMSZMKSI-ZOUJHHRCSA-N |
| XLogP | 4.86 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |