C33H42N2O5 — CID 22441294
[4a-(3-acetyloxyphenyl)-6-[benzoyl(2-methylpropyl)amino]-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate (PubChem CID 22441294) has the molecular formula C33H42N2O5 and a molecular weight of 546.71 g/mol. Its IUPAC name is [4a-(3-acetyloxyphenyl)-6-[benzoyl(2-methylpropyl)amino]-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate.
| Compound Name | [4a-(3-acetyloxyphenyl)-6-[benzoyl(2-methylpropyl)amino]-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate |
|---|---|
| PubChem CID | 22441294 |
| Molecular Formula | C33H42N2O5 |
| Molecular Weight | 546.71 g/mol |
| Exact Mass | 546.31 |
| IUPAC Name | [4a-(3-acetyloxyphenyl)-6-[benzoyl(2-methylpropyl)amino]-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate |
| SMILES | C=CCN1CCC2(c3cccc(OC(C)=O)c3)CC(N(CC(C)C)C(=O)c3ccccc3)CC(OC(C)=O)C2C1 |
| InChI | InChI=1S/C33H42N2O5/c1-6-16-34-17-15-33(27-13-10-14-29(18-27)39-24(4)36)20-28(19-31(30(33)22-34)40-25(5)37)35(21-23(2)3)32(38)26-11-8-7-9-12-26/h6-14,18,23,28,30-31H,1,15-17,19-22H2,2-5H3 |
| InChIKey | CPLRGJBHUOEJPV-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.71 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|