C35H42N2O4 — CID 67728161
[3-[8-hydroxy-6-[2-methylpropyl(naphthalene-2-carbonyl)amino]-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate (PubChem CID 67728161) has the molecular formula C35H42N2O4 and a molecular weight of 554.73 g/mol. Its IUPAC name is [3-[8-hydroxy-6-[2-methylpropyl(naphthalene-2-carbonyl)amino]-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate.
| Compound Name | [3-[8-hydroxy-6-[2-methylpropyl(naphthalene-2-carbonyl)amino]-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate |
|---|---|
| PubChem CID | 67728161 |
| Molecular Formula | C35H42N2O4 |
| Molecular Weight | 554.73 g/mol |
| Exact Mass | 554.31 |
| IUPAC Name | [3-[8-hydroxy-6-[2-methylpropyl(naphthalene-2-carbonyl)amino]-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate |
| SMILES | C=CCN1CCC2(c3cccc(OC(C)=O)c3)CC(N(CC(C)C)C(=O)c3ccc4ccccc4c3)CC(O)C2C1 |
| InChI | InChI=1S/C35H42N2O4/c1-5-16-36-17-15-35(29-11-8-12-31(19-29)41-25(4)38)21-30(20-33(39)32(35)23-36)37(22-24(2)3)34(40)28-14-13-26-9-6-7-10-27(26)18-28/h5-14,18-19,24,30,32-33,39H,1,15-17,20-23H2,2-4H3 |
| InChIKey | VYFPITGXYXQFQM-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.73 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|