C36H44N2O4 — CID 67728303
[2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-6-[2-methylpropyl(naphthalene-2-carbonyl)amino]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate (PubChem CID 67728303) has the molecular formula C36H44N2O4 and a molecular weight of 568.76 g/mol. Its IUPAC name is [2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-6-[2-methylpropyl(naphthalene-2-carbonyl)amino]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate.
| Compound Name | [2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-6-[2-methylpropyl(naphthalene-2-carbonyl)amino]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate |
|---|---|
| PubChem CID | 67728303 |
| Molecular Formula | C36H44N2O4 |
| Molecular Weight | 568.76 g/mol |
| Exact Mass | 568.33 |
| IUPAC Name | [2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-6-[2-methylpropyl(naphthalene-2-carbonyl)amino]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate |
| SMILES | CC(=O)OC1CC(N(CC(C)C)C(=O)c2ccc3ccccc3c2)CC2(c3cccc(O)c3)CCN(CC3CC3)CC12 |
| InChI | InChI=1S/C36H44N2O4/c1-24(2)21-38(35(41)29-14-13-27-7-4-5-8-28(27)17-29)31-19-34(42-25(3)39)33-23-37(22-26-11-12-26)16-15-36(33,20-31)30-9-6-10-32(40)18-30/h4-10,13-14,17-18,24,26,31,33-34,40H,11-12,15-16,19-23H2,1-3H3 |
| InChIKey | MMNYRAXEIUCXMN-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.76 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |