C30H38N2O4 — CID 57148000
[(4aR,6R,8aS)-6-[benzoyl(methyl)amino]-2-(cyclopropylmethyl)-4a-(3-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate (PubChem CID 57148000) has the molecular formula C30H38N2O4 and a molecular weight of 490.64 g/mol. Its IUPAC name is [(4aR,6R,8aS)-6-[benzoyl(methyl)amino]-2-(cyclopropylmethyl)-4a-(3-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate.
| Compound Name | [(4aR,6R,8aS)-6-[benzoyl(methyl)amino]-2-(cyclopropylmethyl)-4a-(3-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate |
|---|---|
| PubChem CID | 57148000 |
| Molecular Formula | C30H38N2O4 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | [(4aR,6R,8aS)-6-[benzoyl(methyl)amino]-2-(cyclopropylmethyl)-4a-(3-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate |
| SMILES | COc1cccc([C@@]23CCN(CC4CC4)C[C@H]2C(OC(C)=O)C[C@H](N(C)C(=O)c2ccccc2)C3)c1 |
| InChI | InChI=1S/C30H38N2O4/c1-21(33)36-28-17-25(31(2)29(34)23-8-5-4-6-9-23)18-30(24-10-7-11-26(16-24)35-3)14-15-32(20-27(28)30)19-22-12-13-22/h4-11,16,22,25,27-28H,12-15,17-20H2,1-3H3/t25-,27-,28?,30-/m0/s1 |
| InChIKey | YKFCJJYLPWJQOC-YAJXQAGCSA-N |
| XLogP | 4.53 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |