C20H30N2O2 — CID 70339229
(6S)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-6-(methylamino)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-ol (PubChem CID 70339229) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is (6S)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-6-(methylamino)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-ol.
| Compound Name | (6S)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-6-(methylamino)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-ol |
|---|---|
| PubChem CID | 70339229 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | (6S)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-6-(methylamino)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-ol |
| SMILES | CN[C@H]1CCC2(O)CN(CC3CC3)CCC2(c2cccc(O)c2)C1 |
| InChI | InChI=1S/C20H30N2O2/c1-21-17-7-8-20(24)14-22(13-15-5-6-15)10-9-19(20,12-17)16-3-2-4-18(23)11-16/h2-4,11,15,17,21,23-24H,5-10,12-14H2,1H3/t17-,19?,20?/m0/s1 |
| InChIKey | FHYMGINQVVTCFJ-KKXNLOMOSA-N |
| XLogP | 2.25 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |