C29H30N2O — CID 67693282
4-(2-benzyl-7-methyl-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazol-4a-yl)phenol (PubChem CID 67693282) has the molecular formula C29H30N2O and a molecular weight of 422.57 g/mol. Its IUPAC name is 4-(2-benzyl-7-methyl-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazol-4a-yl)phenol.
| Compound Name | 4-(2-benzyl-7-methyl-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazol-4a-yl)phenol |
|---|---|
| PubChem CID | 67693282 |
| Molecular Formula | C29H30N2O |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 4-(2-benzyl-7-methyl-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazol-4a-yl)phenol |
| SMILES | Cc1cccc2c3c([nH]c12)CC1(c2ccc(O)cc2)CCN(Cc2ccccc2)CC1C3 |
| InChI | InChI=1S/C29H30N2O/c1-20-6-5-9-25-26-16-23-19-31(18-21-7-3-2-4-8-21)15-14-29(23,17-27(26)30-28(20)25)22-10-12-24(32)13-11-22/h2-13,23,30,32H,14-19H2,1H3 |
| InChIKey | OUTGNBNXVDCMTP-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|