C29H29ClN2O — CID 57274064
3-[(4aS)-7-chloro-2-(2-phenylethyl)-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazol-4a-yl]phenol (PubChem CID 57274064) has the molecular formula C29H29ClN2O and a molecular weight of 457.02 g/mol. Its IUPAC name is 3-[(4aS)-7-chloro-2-(2-phenylethyl)-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazol-4a-yl]phenol.
| Compound Name | 3-[(4aS)-7-chloro-2-(2-phenylethyl)-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazol-4a-yl]phenol |
|---|---|
| PubChem CID | 57274064 |
| Molecular Formula | C29H29ClN2O |
| Molecular Weight | 457.02 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 3-[(4aS)-7-chloro-2-(2-phenylethyl)-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazol-4a-yl]phenol |
| SMILES | Oc1cccc([C@]23CCN(CCc4ccccc4)CC2Cc2c([nH]c4c(Cl)cccc24)C3)c1 |
| InChI | InChI=1S/C29H29ClN2O/c30-26-11-5-10-24-25-17-22-19-32(14-12-20-6-2-1-3-7-20)15-13-29(22,18-27(25)31-28(24)26)21-8-4-9-23(33)16-21/h1-11,16,22,31,33H,12-15,17-19H2/t22?,29-/m1/s1 |
| InChIKey | HNULKSZADNLPCS-OLVCOQPYSA-N |
| XLogP | 6.13 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.02 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|