C29H29N3O3 — CID 19435312
3-[10-nitro-2-(2-phenylethyl)-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazol-4a-yl]phenol (PubChem CID 19435312) has the molecular formula C29H29N3O3 and a molecular weight of 467.57 g/mol. Its IUPAC name is 3-[10-nitro-2-(2-phenylethyl)-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazol-4a-yl]phenol.
| Compound Name | 3-[10-nitro-2-(2-phenylethyl)-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazol-4a-yl]phenol |
|---|---|
| PubChem CID | 19435312 |
| Molecular Formula | C29H29N3O3 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 3-[10-nitro-2-(2-phenylethyl)-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazol-4a-yl]phenol |
| SMILES | O=[N+]([O-])c1cccc2[nH]c3c(c12)CC1CN(CCc2ccccc2)CCC1(c1cccc(O)c1)C3 |
| InChI | InChI=1S/C29H29N3O3/c33-23-9-4-8-21(16-23)29-13-15-31(14-12-20-6-2-1-3-7-20)19-22(29)17-24-26(18-29)30-25-10-5-11-27(28(24)25)32(34)35/h1-11,16,22,30,33H,12-15,17-19H2 |
| InChIKey | HIUXYIFFHNWHJZ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 82.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|