C24H32ClN3O2 — CID 18936203
[8a-(3-hydroxyphenyl)-3,6-dimethyl-4,4a,5,7,8,9-hexahydro-1H-pyrrolo[2,3-g]isoquinolin-2-yl]-pyrrolidin-1-ylmethanone;hydrochloride (PubChem CID 18936203) has the molecular formula C24H32ClN3O2 and a molecular weight of 429.99 g/mol. Its IUPAC name is [8a-(3-hydroxyphenyl)-3,6-dimethyl-4,4a,5,7,8,9-hexahydro-1H-pyrrolo[2,3-g]isoquinolin-2-yl]-pyrrolidin-1-ylmethanone;hydrochloride.
| Compound Name | [8a-(3-hydroxyphenyl)-3,6-dimethyl-4,4a,5,7,8,9-hexahydro-1H-pyrrolo[2,3-g]isoquinolin-2-yl]-pyrrolidin-1-ylmethanone;hydrochloride |
|---|---|
| PubChem CID | 18936203 |
| Molecular Formula | C24H32ClN3O2 |
| Molecular Weight | 429.99 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | [8a-(3-hydroxyphenyl)-3,6-dimethyl-4,4a,5,7,8,9-hexahydro-1H-pyrrolo[2,3-g]isoquinolin-2-yl]-pyrrolidin-1-ylmethanone;hydrochloride |
| SMILES | Cc1c(C(=O)N2CCCC2)[nH]c2c1CC1CN(C)CCC1(c1cccc(O)c1)C2.Cl |
| InChI | InChI=1S/C24H31N3O2.ClH/c1-16-20-13-18-15-26(2)11-8-24(18,17-6-5-7-19(28)12-17)14-21(20)25-22(16)23(29)27-9-3-4-10-27;/h5-7,12,18,25,28H,3-4,8-11,13-15H2,1-2H3;1H |
| InChIKey | QTYJSWJKUUEDRV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 59.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.99 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |