C25H28N2O — CID 154145139
(4aR,12aR)-4a-(3-methoxyphenyl)-2,7-dimethyl-1,3,4,5,12,12a-hexahydropyrido[3,4-b]acridine (PubChem CID 154145139) has the molecular formula C25H28N2O and a molecular weight of 372.51 g/mol. Its IUPAC name is (4aR,12aR)-4a-(3-methoxyphenyl)-2,7-dimethyl-1,3,4,5,12,12a-hexahydropyrido[3,4-b]acridine.
| Compound Name | (4aR,12aR)-4a-(3-methoxyphenyl)-2,7-dimethyl-1,3,4,5,12,12a-hexahydropyrido[3,4-b]acridine |
|---|---|
| PubChem CID | 154145139 |
| Molecular Formula | C25H28N2O |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | (4aR,12aR)-4a-(3-methoxyphenyl)-2,7-dimethyl-1,3,4,5,12,12a-hexahydropyrido[3,4-b]acridine |
| SMILES | COc1cccc([C@@]23CCN(C)C[C@@H]2Cc2cc4cccc(C)c4nc2C3)c1 |
| InChI | InChI=1S/C25H28N2O/c1-17-6-4-7-18-12-19-13-21-16-27(2)11-10-25(21,15-23(19)26-24(17)18)20-8-5-9-22(14-20)28-3/h4-9,12,14,21H,10-11,13,15-16H2,1-3H3/t21-,25-/m0/s1 |
| InChIKey | XNRNRQNREFOBOF-OFVILXPXSA-N |
| XLogP | 4.54 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |