C29H31F3N2O3 — CID 18662093
N-[(4aS,6S,8aR)-8a-hydroxy-4a-(3-hydroxyphenyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-methyl-3-[4-(trifluoromethyl)phenyl]prop-2-ynamide (PubChem CID 18662093) has the molecular formula C29H31F3N2O3 and a molecular weight of 512.57 g/mol. Its IUPAC name is N-[(4aS,6S,8aR)-8a-hydroxy-4a-(3-hydroxyphenyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-methyl-3-[4-(trifluoromethyl)phenyl]prop-2-ynamide.
| Compound Name | N-[(4aS,6S,8aR)-8a-hydroxy-4a-(3-hydroxyphenyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-methyl-3-[4-(trifluoromethyl)phenyl]prop-2-ynamide |
|---|---|
| PubChem CID | 18662093 |
| Molecular Formula | C29H31F3N2O3 |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | N-[(4aS,6S,8aR)-8a-hydroxy-4a-(3-hydroxyphenyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-methyl-3-[4-(trifluoromethyl)phenyl]prop-2-ynamide |
| SMILES | C=CCN1CC[C@@]2(c3cccc(O)c3)C[C@@H](N(C)C(=O)C#Cc3ccc(C(F)(F)F)cc3)CC[C@]2(O)C1 |
| InChI | InChI=1S/C29H31F3N2O3/c1-3-16-34-17-15-27(23-5-4-6-25(35)18-23)19-24(13-14-28(27,37)20-34)33(2)26(36)12-9-21-7-10-22(11-8-21)29(30,31)32/h3-8,10-11,18,24,35,37H,1,13-17,19-20H2,2H3/t24-,27-,28-/m0/s1 |
| InChIKey | HSHWUORODUXZBC-WIRXVTQYSA-N |
| XLogP | 4.33 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|