C29H33F3N2O2 — CID 57319981
N-[2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 57319981) has the molecular formula C29H33F3N2O2 and a molecular weight of 498.59 g/mol. Its IUPAC name is N-[2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | N-[2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 57319981 |
| Molecular Formula | C29H33F3N2O2 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | N-[2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | O=C(C=Cc1cccc(C(F)(F)F)c1)NC1CCC2CN(CC3CC3)CCC2(c2cccc(O)c2)C1 |
| InChI | InChI=1S/C29H33F3N2O2/c30-29(31,32)23-5-1-3-20(15-23)9-12-27(36)33-25-11-10-24-19-34(18-21-7-8-21)14-13-28(24,17-25)22-4-2-6-26(35)16-22/h1-6,9,12,15-16,21,24-25,35H,7-8,10-11,13-14,17-19H2,(H,33,36) |
| InChIKey | XMFYVNMUJIJYPI-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|