C31H33F3N2O4 — CID 18661993
[(4aS,6R,8aR)-4a-(3-methoxyphenyl)-2-prop-2-enyl-6-[3-[4-(trifluoromethyl)phenyl]prop-2-ynoylamino]-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate (PubChem CID 18661993) has the molecular formula C31H33F3N2O4 and a molecular weight of 554.61 g/mol. Its IUPAC name is [(4aS,6R,8aR)-4a-(3-methoxyphenyl)-2-prop-2-enyl-6-[3-[4-(trifluoromethyl)phenyl]prop-2-ynoylamino]-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate.
| Compound Name | [(4aS,6R,8aR)-4a-(3-methoxyphenyl)-2-prop-2-enyl-6-[3-[4-(trifluoromethyl)phenyl]prop-2-ynoylamino]-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate |
|---|---|
| PubChem CID | 18661993 |
| Molecular Formula | C31H33F3N2O4 |
| Molecular Weight | 554.61 g/mol |
| Exact Mass | 554.24 |
| IUPAC Name | [(4aS,6R,8aR)-4a-(3-methoxyphenyl)-2-prop-2-enyl-6-[3-[4-(trifluoromethyl)phenyl]prop-2-ynoylamino]-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate |
| SMILES | C=CCN1CC[C@@]2(c3cccc(OC)c3)C[C@H](NC(=O)C#Cc3ccc(C(F)(F)F)cc3)CC[C@]2(OC(C)=O)C1 |
| InChI | InChI=1S/C31H33F3N2O4/c1-4-17-36-18-16-29(25-6-5-7-27(19-25)39-3)20-26(14-15-30(29,21-36)40-22(2)37)35-28(38)13-10-23-8-11-24(12-9-23)31(32,33)34/h4-9,11-12,19,26H,1,14-18,20-21H2,2-3H3,(H,35,38)/t26-,29+,30+/m1/s1 |
| InChIKey | VMMFMHDUHHRCBR-POLDFPFKSA-N |
| XLogP | 4.87 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.61 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|