C31H35F3N2O3 — CID 57131907
N-[(4aS,6R,8aR)-2-(cyclopropylmethyl)-8a-methoxy-4a-(3-methoxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-3-[4-(trifluoromethyl)phenyl]prop-2-ynamide (PubChem CID 57131907) has the molecular formula C31H35F3N2O3 and a molecular weight of 540.63 g/mol. Its IUPAC name is N-[(4aS,6R,8aR)-2-(cyclopropylmethyl)-8a-methoxy-4a-(3-methoxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-3-[4-(trifluoromethyl)phenyl]prop-2-ynamide.
| Compound Name | N-[(4aS,6R,8aR)-2-(cyclopropylmethyl)-8a-methoxy-4a-(3-methoxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-3-[4-(trifluoromethyl)phenyl]prop-2-ynamide |
|---|---|
| PubChem CID | 57131907 |
| Molecular Formula | C31H35F3N2O3 |
| Molecular Weight | 540.63 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | N-[(4aS,6R,8aR)-2-(cyclopropylmethyl)-8a-methoxy-4a-(3-methoxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-3-[4-(trifluoromethyl)phenyl]prop-2-ynamide |
| SMILES | COc1cccc([C@@]23CCN(CC4CC4)C[C@@]2(OC)CC[C@@H](NC(=O)C#Cc2ccc(C(F)(F)F)cc2)C3)c1 |
| InChI | InChI=1S/C31H35F3N2O3/c1-38-27-5-3-4-25(18-27)29-16-17-36(20-23-6-7-23)21-30(29,39-2)15-14-26(19-29)35-28(37)13-10-22-8-11-24(12-9-22)31(32,33)34/h3-5,8-9,11-12,18,23,26H,6-7,14-17,19-21H2,1-2H3,(H,35,37)/t26-,29+,30+/m1/s1 |
| InChIKey | YDIZYLZRJUHIRD-POLDFPFKSA-N |
| XLogP | 5.17 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.63 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|