C32H39N2O3+ — CID 67669208
N-[(2R,4aS,6R)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-8a-methoxy-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-6-yl]naphthalene-2-carboxamide (PubChem CID 67669208) has the molecular formula C32H39N2O3+ and a molecular weight of 499.68 g/mol. Its IUPAC name is N-[(2R,4aS,6R)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-8a-methoxy-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-6-yl]naphthalene-2-carboxamide.
| Compound Name | N-[(2R,4aS,6R)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-8a-methoxy-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-6-yl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 67669208 |
| Molecular Formula | C32H39N2O3+ |
| Molecular Weight | 499.68 g/mol |
| Exact Mass | 499.30 |
| IUPAC Name | N-[(2R,4aS,6R)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-8a-methoxy-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-6-yl]naphthalene-2-carboxamide |
| SMILES | COC12CC[C@@H](NC(=O)c3ccc4ccccc4c3)C[C@]1(c1cccc(O)c1)CC[N@+](C)(CC1CC1)C2 |
| InChI | InChI=1S/C32H38N2O3/c1-34(21-23-10-11-23)17-16-31(27-8-5-9-29(35)19-27)20-28(14-15-32(31,22-34)37-2)33-30(36)26-13-12-24-6-3-4-7-25(24)18-26/h3-9,12-13,18-19,23,28H,10-11,14-17,20-22H2,1-2H3,(H-,33,35,36)/p+1/t28-,31+,32?,34-/m1/s1 |
| InChIKey | MSRLQVMCKYQXDH-QHFBSYEGSA-O |
| XLogP | 5.41 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.68 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|