C32H36F3N2O4+ — CID 67670685
[(2R,4aS,6S)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-2-methyl-6-[3-[4-(trifluoromethyl)phenyl]prop-2-ynoylamino]-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-8a-yl] acetate (PubChem CID 67670685) has the molecular formula C32H36F3N2O4+ and a molecular weight of 569.64 g/mol. Its IUPAC name is [(2R,4aS,6S)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-2-methyl-6-[3-[4-(trifluoromethyl)phenyl]prop-2-ynoylamino]-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-8a-yl] acetate.
| Compound Name | [(2R,4aS,6S)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-2-methyl-6-[3-[4-(trifluoromethyl)phenyl]prop-2-ynoylamino]-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-8a-yl] acetate |
|---|---|
| PubChem CID | 67670685 |
| Molecular Formula | C32H36F3N2O4+ |
| Molecular Weight | 569.64 g/mol |
| Exact Mass | 569.26 |
| IUPAC Name | [(2R,4aS,6S)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-2-methyl-6-[3-[4-(trifluoromethyl)phenyl]prop-2-ynoylamino]-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-8a-yl] acetate |
| SMILES | CC(=O)OC12CC[C@H](NC(=O)C#Cc3ccc(C(F)(F)F)cc3)C[C@]1(c1cccc(O)c1)CC[N@+](C)(CC1CC1)C2 |
| InChI | InChI=1S/C32H35F3N2O4/c1-22(38)41-31-15-14-27(36-29(40)13-10-23-8-11-25(12-9-23)32(33,34)35)19-30(31,26-4-3-5-28(39)18-26)16-17-37(2,21-31)20-24-6-7-24/h3-5,8-9,11-12,18,24,27H,6-7,14-17,19-21H2,1-2H3,(H-,36,39,40)/p+1/t27-,30-,31?,37+/m0/s1 |
| InChIKey | IKDJIIZHTYFYQJ-HILVMUSISA-O |
| XLogP | 4.93 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.64 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|