C26H33NO2 — CID 70613163
1-[4a-(3-methoxyphenyl)-6-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-(4-methylphenyl)ethanone (PubChem CID 70613163) has the molecular formula C26H33NO2 and a molecular weight of 391.56 g/mol. Its IUPAC name is 1-[4a-(3-methoxyphenyl)-6-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-(4-methylphenyl)ethanone.
| Compound Name | 1-[4a-(3-methoxyphenyl)-6-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-(4-methylphenyl)ethanone |
|---|---|
| PubChem CID | 70613163 |
| Molecular Formula | C26H33NO2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | 1-[4a-(3-methoxyphenyl)-6-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-(4-methylphenyl)ethanone |
| SMILES | COc1cccc(C23CCN(C(=O)Cc4ccc(C)cc4)CC2CCC(C)C3)c1 |
| InChI | InChI=1S/C26H33NO2/c1-19-7-10-21(11-8-19)15-25(28)27-14-13-26(17-20(2)9-12-23(26)18-27)22-5-4-6-24(16-22)29-3/h4-8,10-11,16,20,23H,9,12-15,17-18H2,1-3H3 |
| InChIKey | HKNMIBQWLLRVDR-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |