C15H18N2O3 — CID 122385368
(7S,7aS)-7a-(3-methoxyphenyl)-2,7-dimethyl-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-1,3-dione (PubChem CID 122385368) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is (7S,7aS)-7a-(3-methoxyphenyl)-2,7-dimethyl-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-1,3-dione.
| Compound Name | (7S,7aS)-7a-(3-methoxyphenyl)-2,7-dimethyl-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-1,3-dione |
|---|---|
| PubChem CID | 122385368 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | (7S,7aS)-7a-(3-methoxyphenyl)-2,7-dimethyl-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-1,3-dione |
| SMILES | COc1cccc([C@@]23C(=O)N(C)C(=O)N2CC[C@@H]3C)c1 |
| InChI | InChI=1S/C15H18N2O3/c1-10-7-8-17-14(19)16(2)13(18)15(10,17)11-5-4-6-12(9-11)20-3/h4-6,9-10H,7-8H2,1-3H3/t10-,15-/m0/s1 |
| InChIKey | QMUQIHJOLJWAJW-BONVTDFDSA-N |
| XLogP | 1.82 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|