C26H31NO3 — CID 86736476
(4aR,8aS)-4a-(3-methoxyphenyl)-2-(4-phenylbutyl)-4,5,6,7,8,8a-hexahydroisoquinoline-1,3-dione (PubChem CID 86736476) has the molecular formula C26H31NO3 and a molecular weight of 405.54 g/mol. Its IUPAC name is (4aR,8aS)-4a-(3-methoxyphenyl)-2-(4-phenylbutyl)-4,5,6,7,8,8a-hexahydroisoquinoline-1,3-dione.
| Compound Name | (4aR,8aS)-4a-(3-methoxyphenyl)-2-(4-phenylbutyl)-4,5,6,7,8,8a-hexahydroisoquinoline-1,3-dione |
|---|---|
| PubChem CID | 86736476 |
| Molecular Formula | C26H31NO3 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | (4aR,8aS)-4a-(3-methoxyphenyl)-2-(4-phenylbutyl)-4,5,6,7,8,8a-hexahydroisoquinoline-1,3-dione |
| SMILES | COc1cccc([C@@]23CCCC[C@@H]2C(=O)N(CCCCc2ccccc2)C(=O)C3)c1 |
| InChI | InChI=1S/C26H31NO3/c1-30-22-14-9-13-21(18-22)26-16-7-5-15-23(26)25(29)27(24(28)19-26)17-8-6-12-20-10-3-2-4-11-20/h2-4,9-11,13-14,18,23H,5-8,12,15-17,19H2,1H3/t23-,26+/m1/s1 |
| InChIKey | JDKLCDAEMNIKBN-BVAGGSTKSA-N |
| XLogP | 4.91 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|