C14H15IO2 — CID 102114565
(3S,4S)-3-iodo-8-methoxyspiro[2,3-dihydro-1H-naphthalene-4,2'-cyclobutane]-1'-one (PubChem CID 102114565) has the molecular formula C14H15IO2 and a molecular weight of 342.18 g/mol. Its IUPAC name is (3S,4S)-3-iodo-8-methoxyspiro[2,3-dihydro-1H-naphthalene-4,2'-cyclobutane]-1'-one.
| Compound Name | (3S,4S)-3-iodo-8-methoxyspiro[2,3-dihydro-1H-naphthalene-4,2'-cyclobutane]-1'-one |
|---|---|
| PubChem CID | 102114565 |
| Molecular Formula | C14H15IO2 |
| Molecular Weight | 342.18 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | (3S,4S)-3-iodo-8-methoxyspiro[2,3-dihydro-1H-naphthalene-4,2'-cyclobutane]-1'-one |
| SMILES | COc1cccc2c1CC[C@H](I)[C@@]21CCC1=O |
| InChI | InChI=1S/C14H15IO2/c1-17-11-4-2-3-10-9(11)5-6-12(15)14(10)8-7-13(14)16/h2-4,12H,5-8H2,1H3/t12-,14+/m0/s1 |
| InChIKey | JYMFREJDSCJMEM-GXTWGEPZSA-N |
| XLogP | 3.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.18 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|