C17H22F3N — CID 142943738
(4bR)-4b,8-dimethyl-8-(trifluoromethyl)-5,6,7,8a,9,10-hexahydrophenanthren-2-amine (PubChem CID 142943738) has the molecular formula C17H22F3N and a molecular weight of 297.36 g/mol. Its IUPAC name is (4bR)-4b,8-dimethyl-8-(trifluoromethyl)-5,6,7,8a,9,10-hexahydrophenanthren-2-amine.
| Compound Name | (4bR)-4b,8-dimethyl-8-(trifluoromethyl)-5,6,7,8a,9,10-hexahydrophenanthren-2-amine |
|---|---|
| PubChem CID | 142943738 |
| Molecular Formula | C17H22F3N |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | (4bR)-4b,8-dimethyl-8-(trifluoromethyl)-5,6,7,8a,9,10-hexahydrophenanthren-2-amine |
| SMILES | CC1(C(F)(F)F)CCC[C@@]2(C)c3ccc(N)cc3CCC12 |
| InChI | InChI=1S/C17H22F3N/c1-15-8-3-9-16(2,17(18,19)20)14(15)7-4-11-10-12(21)5-6-13(11)15/h5-6,10,14H,3-4,7-9,21H2,1-2H3/t14?,15-,16?/m0/s1 |
| InChIKey | AAQJQOCKVVRENN-PCKAHOCUSA-N |
| XLogP | 4.84 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|