C21H29NO2 — CID 11484239
1,4a-dimethyl-7-(2-methylpropanoyl)-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxamide (PubChem CID 11484239) has the molecular formula C21H29NO2 and a molecular weight of 327.47 g/mol. Its IUPAC name is 1,4a-dimethyl-7-(2-methylpropanoyl)-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxamide.
| Compound Name | 1,4a-dimethyl-7-(2-methylpropanoyl)-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxamide |
|---|---|
| PubChem CID | 11484239 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | 1,4a-dimethyl-7-(2-methylpropanoyl)-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxamide |
| SMILES | CC(C)C(=O)c1ccc2c(c1)CCC1C(C)(C(N)=O)CCCC21C |
| InChI | InChI=1S/C21H29NO2/c1-13(2)18(23)15-6-8-16-14(12-15)7-9-17-20(16,3)10-5-11-21(17,4)19(22)24/h6,8,12-13,17H,5,7,9-11H2,1-4H3,(H2,22,24) |
| InChIKey | BCXHYFBFMNOTHO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |