C21H27F3O2 — CID 162545241
4b,8-dimethyl-2-propan-2-yl-8-(trifluoromethyl)-5,6,7,8a,9,10-hexahydrophenanthrene-3-carboxylic acid (PubChem CID 162545241) has the molecular formula C21H27F3O2 and a molecular weight of 368.44 g/mol. Its IUPAC name is 4b,8-dimethyl-2-propan-2-yl-8-(trifluoromethyl)-5,6,7,8a,9,10-hexahydrophenanthrene-3-carboxylic acid.
| Compound Name | 4b,8-dimethyl-2-propan-2-yl-8-(trifluoromethyl)-5,6,7,8a,9,10-hexahydrophenanthrene-3-carboxylic acid |
|---|---|
| PubChem CID | 162545241 |
| Molecular Formula | C21H27F3O2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 4b,8-dimethyl-2-propan-2-yl-8-(trifluoromethyl)-5,6,7,8a,9,10-hexahydrophenanthrene-3-carboxylic acid |
| SMILES | CC(C)c1cc2c(cc1C(=O)O)C1(C)CCCC(C)(C(F)(F)F)C1CC2 |
| InChI | InChI=1S/C21H27F3O2/c1-12(2)14-10-13-6-7-17-19(3,16(13)11-15(14)18(25)26)8-5-9-20(17,4)21(22,23)24/h10-12,17H,5-9H2,1-4H3,(H,25,26) |
| InChIKey | ZSQFBFVHWIOBAX-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |