C27H39NO3 — CID 141365649
(1R,4aS)-1,4a-dimethyl-7-propan-2-yl-6-[(E)-C-propan-2-yl-N-prop-2-enoxycarbonimidoyl]-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid (PubChem CID 141365649) has the molecular formula C27H39NO3 and a molecular weight of 425.61 g/mol. Its IUPAC name is (1R,4aS)-1,4a-dimethyl-7-propan-2-yl-6-[(E)-C-propan-2-yl-N-prop-2-enoxycarbonimidoyl]-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid.
| Compound Name | (1R,4aS)-1,4a-dimethyl-7-propan-2-yl-6-[(E)-C-propan-2-yl-N-prop-2-enoxycarbonimidoyl]-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
|---|---|
| PubChem CID | 141365649 |
| Molecular Formula | C27H39NO3 |
| Molecular Weight | 425.61 g/mol |
| Exact Mass | 425.29 |
| IUPAC Name | (1R,4aS)-1,4a-dimethyl-7-propan-2-yl-6-[(E)-C-propan-2-yl-N-prop-2-enoxycarbonimidoyl]-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
| SMILES | C=CCO/N=C(/c1cc2c(cc1C(C)C)CCC1[C@](C)(C(=O)O)CCC[C@]21C)C(C)C |
| InChI | InChI=1S/C27H39NO3/c1-8-14-31-28-24(18(4)5)21-16-22-19(15-20(21)17(2)3)10-11-23-26(22,6)12-9-13-27(23,7)25(29)30/h8,15-18,23H,1,9-14H2,2-7H3,(H,29,30)/b28-24+/t23?,26-,27-/m1/s1 |
| InChIKey | YSGUAIPNMSYUQK-SIAAKBAJSA-N |
| XLogP | 6.47 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.61 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|