C31H41NO3 — CID 134156413
(1R,4aS,10aR)-1,4a-dimethyl-6-(N-phenylmethoxy-C-propylcarbonimidoyl)-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid (PubChem CID 134156413) has the molecular formula C31H41NO3 and a molecular weight of 475.67 g/mol. Its IUPAC name is (1R,4aS,10aR)-1,4a-dimethyl-6-(N-phenylmethoxy-C-propylcarbonimidoyl)-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid.
| Compound Name | (1R,4aS,10aR)-1,4a-dimethyl-6-(N-phenylmethoxy-C-propylcarbonimidoyl)-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
|---|---|
| PubChem CID | 134156413 |
| Molecular Formula | C31H41NO3 |
| Molecular Weight | 475.67 g/mol |
| Exact Mass | 475.31 |
| IUPAC Name | (1R,4aS,10aR)-1,4a-dimethyl-6-(N-phenylmethoxy-C-propylcarbonimidoyl)-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
| SMILES | CCCC(=NOCc1ccccc1)c1cc2c(cc1C(C)C)CC[C@H]1[C@](C)(C(=O)O)CCC[C@]21C |
| InChI | InChI=1S/C31H41NO3/c1-6-11-27(32-35-20-22-12-8-7-9-13-22)25-19-26-23(18-24(25)21(2)3)14-15-28-30(26,4)16-10-17-31(28,5)29(33)34/h7-9,12-13,18-19,21,28H,6,10-11,14-17,20H2,1-5H3,(H,33,34)/t28-,30-,31-/m1/s1 |
| InChIKey | BYAKQSSXAUNWKS-JJEZKPMQSA-N |
| XLogP | 7.63 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.67 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|