C28H34BrNO3 — CID 141365652
(1R,4aS)-6-[(E)-(4-bromophenyl)methoxyiminomethyl]-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid (PubChem CID 141365652) has the molecular formula C28H34BrNO3 and a molecular weight of 512.49 g/mol. Its IUPAC name is (1R,4aS)-6-[(E)-(4-bromophenyl)methoxyiminomethyl]-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid.
| Compound Name | (1R,4aS)-6-[(E)-(4-bromophenyl)methoxyiminomethyl]-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
|---|---|
| PubChem CID | 141365652 |
| Molecular Formula | C28H34BrNO3 |
| Molecular Weight | 512.49 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | (1R,4aS)-6-[(E)-(4-bromophenyl)methoxyiminomethyl]-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
| SMILES | CC(C)c1cc2c(cc1/C=N/OCc1ccc(Br)cc1)[C@@]1(C)CCC[C@@](C)(C(=O)O)C1CC2 |
| InChI | InChI=1S/C28H34BrNO3/c1-18(2)23-14-20-8-11-25-27(3,12-5-13-28(25,4)26(31)32)24(20)15-21(23)16-30-33-17-19-6-9-22(29)10-7-19/h6-7,9-10,14-16,18,25H,5,8,11-13,17H2,1-4H3,(H,31,32)/b30-16+/t25?,27-,28-/m1/s1 |
| InChIKey | JLNLLQKOOGFERU-KNXXZQKXSA-N |
| XLogP | 7.22 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.49 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|