About 6-bromo-1-nitroso-2,3-dihydro-1H-indene
6-bromo-1-nitroso-2,3-dihydro-1H-indene (PubChem CID 90991723) has the molecular formula C9H8BrNO
and a molecular weight of 226.07 g/mol. Its IUPAC name is 6-bromo-1-nitroso-2,3-dihydro-1H-indene.
Molecular Properties
| Compound Name | 6-bromo-1-nitroso-2,3-dihydro-1H-indene |
| PubChem CID | 90991723 |
| Molecular Formula | C9H8BrNO |
| Molecular Weight | 226.07 g/mol |
| Exact Mass | 224.98 |
| IUPAC Name | 6-bromo-1-nitroso-2,3-dihydro-1H-indene |
| SMILES | O=NC1CCc2ccc(Br)cc21 |
| InChI | InChI=1S/C9H8BrNO/c10-7-3-1-6-2-4-9(11-12)8(6)5-7/h1,3,5,9H,2,4H2 |
| InChIKey | WFCBSJCQJWZWOR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.07 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-1-nitroso-2,3-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1-nitroso-2,3-dihydro-1H-indene?
The IUPAC name of 6-bromo-1-nitroso-2,3-dihydro-1H-indene (CID 90991723) is 6-bromo-1-nitroso-2,3-dihydro-1H-indene.
What is the SMILES notation for 6-bromo-1-nitroso-2,3-dihydro-1H-indene?
The canonical SMILES for 6-bromo-1-nitroso-2,3-dihydro-1H-indene is O=NC1CCc2ccc(Br)cc21.
What is the InChIKey of 6-bromo-1-nitroso-2,3-dihydro-1H-indene?
The InChIKey is WFCBSJCQJWZWOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrNO/c10-7-3-1-6-2-4-9(11-12)8(6)5-7/h1,3,5,9H,2,4H2.
What are the key properties of 6-bromo-1-nitroso-2,3-dihydro-1H-indene?
6-bromo-1-nitroso-2,3-dihydro-1H-indene has a molecular weight of 226.07 g/mol, XLogP of 3.20, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1-nitroso-2,3-dihydro-1H-indene is sourced from PubChem (CID 90991723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).