C12H13N — CID 82074815
6-ethyl-2,3-dihydro-1H-indene-1-carbonitrile (PubChem CID 82074815) has the molecular formula C12H13N and a molecular weight of 171.24 g/mol. Its IUPAC name is 6-ethyl-2,3-dihydro-1H-indene-1-carbonitrile.
| Compound Name | 6-ethyl-2,3-dihydro-1H-indene-1-carbonitrile |
|---|---|
| PubChem CID | 82074815 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 6-ethyl-2,3-dihydro-1H-indene-1-carbonitrile |
| SMILES | CCc1ccc2c(c1)C(C#N)CC2 |
| InChI | InChI=1S/C12H13N/c1-2-9-3-4-10-5-6-11(8-13)12(10)7-9/h3-4,7,11H,2,5-6H2,1H3 |
| InChIKey | VGWZREOUIHKTCI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |