C12H15Br — CID 63514071
1-bromo-7-ethyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 63514071) has the molecular formula C12H15Br and a molecular weight of 239.16 g/mol. Its IUPAC name is 1-bromo-7-ethyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-bromo-7-ethyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 63514071 |
| Molecular Formula | C12H15Br |
| Molecular Weight | 239.16 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 1-bromo-7-ethyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCc1ccc2c(c1)C(Br)CCC2 |
| InChI | InChI=1S/C12H15Br/c1-2-9-6-7-10-4-3-5-12(13)11(10)8-9/h6-8,12H,2-5H2,1H3 |
| InChIKey | RIUCUVKEROCVIE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.16 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|