About 6-ethoxy-2,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium
6-ethoxy-2,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium (PubChem CID 3029150) has the molecular formula C13H20NO+
and a molecular weight of 206.31 g/mol. Its IUPAC name is 6-ethoxy-2,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium.
Molecular Properties
| Compound Name | 6-ethoxy-2,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium |
| PubChem CID | 3029150 |
| Molecular Formula | C13H20NO+ |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 6-ethoxy-2,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium |
| SMILES | CCOc1ccc2c(c1)CC[N+](C)(C)C2 |
| InChI | InChI=1S/C13H20NO/c1-4-15-13-6-5-12-10-14(2,3)8-7-11(12)9-13/h5-6,9H,4,7-8,10H2,1-3H3/q+1 |
| InChIKey | AWPKHERQGZBOHV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 6-ethoxy-2,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethoxy-2,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium?
The IUPAC name of 6-ethoxy-2,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium (CID 3029150) is 6-ethoxy-2,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium.
What is the SMILES notation for 6-ethoxy-2,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium?
The canonical SMILES for 6-ethoxy-2,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium is CCOc1ccc2c(c1)CC[N+](C)(C)C2.
What is the InChIKey of 6-ethoxy-2,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium?
The InChIKey is AWPKHERQGZBOHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20NO/c1-4-15-13-6-5-12-10-14(2,3)8-7-11(12)9-13/h5-6,9H,4,7-8,10H2,1-3H3/q+1.
What are the key properties of 6-ethoxy-2,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium?
6-ethoxy-2,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium has a molecular weight of 206.31 g/mol, XLogP of 2.22, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethoxy-2,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium is sourced from PubChem (CID 3029150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).