C10H14N2O — CID 163217090
1,1-dideuterio-6-methoxy-3,4-dihydro-2H-isoquinolin-7-amine (PubChem CID 163217090) has the molecular formula C10H14N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 1,1-dideuterio-6-methoxy-3,4-dihydro-2H-isoquinolin-7-amine.
| Compound Name | 1,1-dideuterio-6-methoxy-3,4-dihydro-2H-isoquinolin-7-amine |
|---|---|
| PubChem CID | 163217090 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 1,1-dideuterio-6-methoxy-3,4-dihydro-2H-isoquinolin-7-amine |
| SMILES | [2H]C1([2H])NCCc2cc(OC)c(N)cc21 |
| InChI | InChI=1S/C10H14N2O/c1-13-10-5-7-2-3-12-6-8(7)4-9(10)11/h4-5,12H,2-3,6,11H2,1H3/i6D2 |
| InChIKey | WYKOLQWGOISOAU-NCYHJHSESA-N |
| XLogP | 0.92 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|