C14H21NO — CID 134579876
2-methoxy-7-methyl-5,6,7,8,9,10-hexahydrobenzo[8]annulen-3-amine (PubChem CID 134579876) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is 2-methoxy-7-methyl-5,6,7,8,9,10-hexahydrobenzo[8]annulen-3-amine.
| Compound Name | 2-methoxy-7-methyl-5,6,7,8,9,10-hexahydrobenzo[8]annulen-3-amine |
|---|---|
| PubChem CID | 134579876 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 2-methoxy-7-methyl-5,6,7,8,9,10-hexahydrobenzo[8]annulen-3-amine |
| SMILES | COc1cc2c(cc1N)CCC(C)CCC2 |
| InChI | InChI=1S/C14H21NO/c1-10-4-3-5-11-9-14(16-2)13(15)8-12(11)7-6-10/h8-10H,3-7,15H2,1-2H3 |
| InChIKey | RDIUHJAADNJTLX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|