C11H16N2O — CID 168846425
2-methyl-6-(trideuteriomethoxy)-3,4-dihydro-1H-isoquinolin-7-amine (PubChem CID 168846425) has the molecular formula C11H16N2O and a molecular weight of 195.28 g/mol. Its IUPAC name is 2-methyl-6-(trideuteriomethoxy)-3,4-dihydro-1H-isoquinolin-7-amine.
| Compound Name | 2-methyl-6-(trideuteriomethoxy)-3,4-dihydro-1H-isoquinolin-7-amine |
|---|---|
| PubChem CID | 168846425 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 195.28 g/mol |
| Exact Mass | 195.15 |
| IUPAC Name | 2-methyl-6-(trideuteriomethoxy)-3,4-dihydro-1H-isoquinolin-7-amine |
| SMILES | [2H]C([2H])([2H])Oc1cc2c(cc1N)CN(C)CC2 |
| InChI | InChI=1S/C11H16N2O/c1-13-4-3-8-6-11(14-2)10(12)5-9(8)7-13/h5-6H,3-4,7,12H2,1-2H3/i2D3 |
| InChIKey | XRHYBSPANQDMJG-BMSJAHLVSA-N |
| XLogP | 1.27 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.28 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|