C16H16ClNO — CID 115104384
6-[(2-chlorophenoxy)methyl]-1,2,3,4-tetrahydroquinoline (PubChem CID 115104384) has the molecular formula C16H16ClNO and a molecular weight of 273.76 g/mol. Its IUPAC name is 6-[(2-chlorophenoxy)methyl]-1,2,3,4-tetrahydroquinoline.
| Compound Name | 6-[(2-chlorophenoxy)methyl]-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 115104384 |
| Molecular Formula | C16H16ClNO |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 6-[(2-chlorophenoxy)methyl]-1,2,3,4-tetrahydroquinoline |
| SMILES | Clc1ccccc1OCc1ccc2c(c1)CCCN2 |
| InChI | InChI=1S/C16H16ClNO/c17-14-5-1-2-6-16(14)19-11-12-7-8-15-13(10-12)4-3-9-18-15/h1-2,5-8,10,18H,3-4,9,11H2 |
| InChIKey | NDOICKFQJOBUQC-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |