C16H18N2 — CID 61149619
N-(1,2,3,4-tetrahydroquinolin-6-ylmethyl)aniline (PubChem CID 61149619) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is N-(1,2,3,4-tetrahydroquinolin-6-ylmethyl)aniline.
| Compound Name | N-(1,2,3,4-tetrahydroquinolin-6-ylmethyl)aniline |
|---|---|
| PubChem CID | 61149619 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | N-(1,2,3,4-tetrahydroquinolin-6-ylmethyl)aniline |
| SMILES | c1ccc(NCc2ccc3c(c2)CCCN3)cc1 |
| InChI | InChI=1S/C16H18N2/c1-2-6-15(7-3-1)18-12-13-8-9-16-14(11-13)5-4-10-17-16/h1-3,6-9,11,17-18H,4-5,10,12H2 |
| InChIKey | GJAFZKJIFZDFBZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |