C18H18FNO — CID 114523652
7-[(3-cyclopropyloxyphenyl)-fluoromethyl]-2,3-dihydro-1H-indole (PubChem CID 114523652) has the molecular formula C18H18FNO and a molecular weight of 283.35 g/mol. Its IUPAC name is 7-[(3-cyclopropyloxyphenyl)-fluoromethyl]-2,3-dihydro-1H-indole.
| Compound Name | 7-[(3-cyclopropyloxyphenyl)-fluoromethyl]-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 114523652 |
| Molecular Formula | C18H18FNO |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 7-[(3-cyclopropyloxyphenyl)-fluoromethyl]-2,3-dihydro-1H-indole |
| SMILES | FC(c1cccc(OC2CC2)c1)c1cccc2c1NCC2 |
| InChI | InChI=1S/C18H18FNO/c19-17(16-6-2-3-12-9-10-20-18(12)16)13-4-1-5-15(11-13)21-14-7-8-14/h1-6,11,14,17,20H,7-10H2 |
| InChIKey | VPKSMWDLIOHVFN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |