C13H11BrFNO — CID 113394348
7-[(3-bromofuran-2-yl)-fluoromethyl]-2,3-dihydro-1H-indole (PubChem CID 113394348) has the molecular formula C13H11BrFNO and a molecular weight of 296.14 g/mol. Its IUPAC name is 7-[(3-bromofuran-2-yl)-fluoromethyl]-2,3-dihydro-1H-indole.
| Compound Name | 7-[(3-bromofuran-2-yl)-fluoromethyl]-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 113394348 |
| Molecular Formula | C13H11BrFNO |
| Molecular Weight | 296.14 g/mol |
| Exact Mass | 295.00 |
| IUPAC Name | 7-[(3-bromofuran-2-yl)-fluoromethyl]-2,3-dihydro-1H-indole |
| SMILES | FC(c1cccc2c1NCC2)c1occc1Br |
| InChI | InChI=1S/C13H11BrFNO/c14-10-5-7-17-13(10)11(15)9-3-1-2-8-4-6-16-12(8)9/h1-3,5,7,11,16H,4,6H2 |
| InChIKey | ARDCWUSKDQVASL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.14 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |