About 7-(difluoromethoxy)-2,3-dihydro-1H-indole
7-(difluoromethoxy)-2,3-dihydro-1H-indole (PubChem CID 16786288) has the molecular formula C9H9F2NO
and a molecular weight of 185.17 g/mol. Its IUPAC name is 7-(difluoromethoxy)-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 7-(difluoromethoxy)-2,3-dihydro-1H-indole |
| PubChem CID | 16786288 |
| Molecular Formula | C9H9F2NO |
| Molecular Weight | 185.17 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 7-(difluoromethoxy)-2,3-dihydro-1H-indole |
| SMILES | FC(F)Oc1cccc2c1NCC2 |
| InChI | InChI=1S/C9H9F2NO/c10-9(11)13-7-3-1-2-6-4-5-12-8(6)7/h1-3,9,12H,4-5H2 |
| InChIKey | SYVOSYMMUILTFK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.17 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-(difluoromethoxy)-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(difluoromethoxy)-2,3-dihydro-1H-indole?
The IUPAC name of 7-(difluoromethoxy)-2,3-dihydro-1H-indole (CID 16786288) is 7-(difluoromethoxy)-2,3-dihydro-1H-indole.
What is the SMILES notation for 7-(difluoromethoxy)-2,3-dihydro-1H-indole?
The canonical SMILES for 7-(difluoromethoxy)-2,3-dihydro-1H-indole is FC(F)Oc1cccc2c1NCC2.
What is the InChIKey of 7-(difluoromethoxy)-2,3-dihydro-1H-indole?
The InChIKey is SYVOSYMMUILTFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F2NO/c10-9(11)13-7-3-1-2-6-4-5-12-8(6)7/h1-3,9,12H,4-5H2.
What are the key properties of 7-(difluoromethoxy)-2,3-dihydro-1H-indole?
7-(difluoromethoxy)-2,3-dihydro-1H-indole has a molecular weight of 185.17 g/mol, XLogP of 2.26, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(difluoromethoxy)-2,3-dihydro-1H-indole is sourced from PubChem (CID 16786288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).